About 2-cyclohexa-1,3-dien-1-yl-2-cyclohexa-2,4-dien-1-ylethanamine
2-cyclohexa-1,3-dien-1-yl-2-cyclohexa-2,4-dien-1-ylethanamine (PubChem CID 90918343) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-yl-2-cyclohexa-2,4-dien-1-ylethanamine.
Molecular Properties
| Compound Name | 2-cyclohexa-1,3-dien-1-yl-2-cyclohexa-2,4-dien-1-ylethanamine |
| PubChem CID | 90918343 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-yl-2-cyclohexa-2,4-dien-1-ylethanamine |
| SMILES | NCC(C1=CC=CCC1)C1C=CC=CC1 |
| InChI | InChI=1S/C14H19N/c15-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-5,7,9,12,14H,6,8,10-11,15H2 |
| InChIKey | OIENJHVAMNNPDV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclohexa-1,3-dien-1-yl-2-cyclohexa-2,4-dien-1-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-1,3-dien-1-yl-2-cyclohexa-2,4-dien-1-ylethanamine?
The IUPAC name of 2-cyclohexa-1,3-dien-1-yl-2-cyclohexa-2,4-dien-1-ylethanamine (CID 90918343) is 2-cyclohexa-1,3-dien-1-yl-2-cyclohexa-2,4-dien-1-ylethanamine.
What is the SMILES notation for 2-cyclohexa-1,3-dien-1-yl-2-cyclohexa-2,4-dien-1-ylethanamine?
The canonical SMILES for 2-cyclohexa-1,3-dien-1-yl-2-cyclohexa-2,4-dien-1-ylethanamine is NCC(C1=CC=CCC1)C1C=CC=CC1.
What is the InChIKey of 2-cyclohexa-1,3-dien-1-yl-2-cyclohexa-2,4-dien-1-ylethanamine?
The InChIKey is OIENJHVAMNNPDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N/c15-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-5,7,9,12,14H,6,8,10-11,15H2.
What are the key properties of 2-cyclohexa-1,3-dien-1-yl-2-cyclohexa-2,4-dien-1-ylethanamine?
2-cyclohexa-1,3-dien-1-yl-2-cyclohexa-2,4-dien-1-ylethanamine has a molecular weight of 201.31 g/mol, XLogP of 2.97, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-1,3-dien-1-yl-2-cyclohexa-2,4-dien-1-ylethanamine is sourced from PubChem (CID 90918343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).