C32H28N2O3 — CID 90918469
4-[1,1-bis(4-hydroxyphenyl)-3,4-dipyridin-4-ylbutyl]phenol (PubChem CID 90918469) has the molecular formula C32H28N2O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is 4-[1,1-bis(4-hydroxyphenyl)-3,4-dipyridin-4-ylbutyl]phenol.
| Compound Name | 4-[1,1-bis(4-hydroxyphenyl)-3,4-dipyridin-4-ylbutyl]phenol |
|---|---|
| PubChem CID | 90918469 |
| Molecular Formula | C32H28N2O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 4-[1,1-bis(4-hydroxyphenyl)-3,4-dipyridin-4-ylbutyl]phenol |
| SMILES | Oc1ccc(C(CC(Cc2ccncc2)c2ccncc2)(c2ccc(O)cc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C32H28N2O3/c35-29-7-1-26(2-8-29)32(27-3-9-30(36)10-4-27,28-5-11-31(37)12-6-28)22-25(24-15-19-34-20-16-24)21-23-13-17-33-18-14-23/h1-20,25,35-37H,21-22H2 |
| InChIKey | FOCGANSWURQZPX-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|