About 4-(6-bromo-3-pyridinyl)-2,6-dipyridin-2-ylpyridine
4-(6-bromo-3-pyridinyl)-2,6-dipyridin-2-ylpyridine (PubChem CID 90918546) has the molecular formula C20H13BrN4
and a molecular weight of 389.26 g/mol. Its IUPAC name is 4-(6-bromo-3-pyridinyl)-2,6-dipyridin-2-ylpyridine.
Molecular Properties
| Compound Name | 4-(6-bromo-3-pyridinyl)-2,6-dipyridin-2-ylpyridine |
| PubChem CID | 90918546 |
| Molecular Formula | C20H13BrN4 |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | 4-(6-bromo-3-pyridinyl)-2,6-dipyridin-2-ylpyridine |
| SMILES | Brc1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cn1 |
| InChI | InChI=1S/C20H13BrN4/c21-20-8-7-14(13-24-20)15-11-18(16-5-1-3-9-22-16)25-19(12-15)17-6-2-4-10-23-17/h1-13H |
| InChIKey | IDHUBTLWWXNSTR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-bromo-3-pyridinyl)-2,6-dipyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-bromo-3-pyridinyl)-2,6-dipyridin-2-ylpyridine?
The IUPAC name of 4-(6-bromo-3-pyridinyl)-2,6-dipyridin-2-ylpyridine (CID 90918546) is 4-(6-bromo-3-pyridinyl)-2,6-dipyridin-2-ylpyridine.
What is the SMILES notation for 4-(6-bromo-3-pyridinyl)-2,6-dipyridin-2-ylpyridine?
The canonical SMILES for 4-(6-bromo-3-pyridinyl)-2,6-dipyridin-2-ylpyridine is Brc1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cn1.
What is the InChIKey of 4-(6-bromo-3-pyridinyl)-2,6-dipyridin-2-ylpyridine?
The InChIKey is IDHUBTLWWXNSTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13BrN4/c21-20-8-7-14(13-24-20)15-11-18(16-5-1-3-9-22-16)25-19(12-15)17-6-2-4-10-23-17/h1-13H.
What are the key properties of 4-(6-bromo-3-pyridinyl)-2,6-dipyridin-2-ylpyridine?
4-(6-bromo-3-pyridinyl)-2,6-dipyridin-2-ylpyridine has a molecular weight of 389.26 g/mol, XLogP of 5.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-bromo-3-pyridinyl)-2,6-dipyridin-2-ylpyridine is sourced from PubChem (CID 90918546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).