C11H21NO3S2 — CID 90918671
4-methylsulfanyl-2-[(4-methylsulfanylbutanoylamino)methyl]butanoic acid (PubChem CID 90918671) has the molecular formula C11H21NO3S2 and a molecular weight of 279.43 g/mol. Its IUPAC name is 4-methylsulfanyl-2-[(4-methylsulfanylbutanoylamino)methyl]butanoic acid.
| Compound Name | 4-methylsulfanyl-2-[(4-methylsulfanylbutanoylamino)methyl]butanoic acid |
|---|---|
| PubChem CID | 90918671 |
| Molecular Formula | C11H21NO3S2 |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 4-methylsulfanyl-2-[(4-methylsulfanylbutanoylamino)methyl]butanoic acid |
| SMILES | CSCCCC(=O)NCC(CCSC)C(=O)O |
| InChI | InChI=1S/C11H21NO3S2/c1-16-6-3-4-10(13)12-8-9(11(14)15)5-7-17-2/h9H,3-8H2,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | MNEFKDDNRCMHOS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|