C20H21N3O7S — CID 90918824
N-hydroxy-N-[[4-(2-pyridin-4-ylethoxy)phenyl]sulfonylamino]-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole-5-carboxamide (PubChem CID 90918824) has the molecular formula C20H21N3O7S and a molecular weight of 447.47 g/mol. Its IUPAC name is N-hydroxy-N-[[4-(2-pyridin-4-ylethoxy)phenyl]sulfonylamino]-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole-5-carboxamide.
| Compound Name | N-hydroxy-N-[[4-(2-pyridin-4-ylethoxy)phenyl]sulfonylamino]-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole-5-carboxamide |
|---|---|
| PubChem CID | 90918824 |
| Molecular Formula | C20H21N3O7S |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | N-hydroxy-N-[[4-(2-pyridin-4-ylethoxy)phenyl]sulfonylamino]-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole-5-carboxamide |
| SMILES | O=C(C1=CC2OCOC2C1)N(O)NS(=O)(=O)c1ccc(OCCc2ccncc2)cc1 |
| InChI | InChI=1S/C20H21N3O7S/c24-20(15-11-18-19(12-15)30-13-29-18)23(25)22-31(26,27)17-3-1-16(2-4-17)28-10-7-14-5-8-21-9-6-14/h1-6,8-9,11,18-19,22,25H,7,10,12-13H2 |
| InChIKey | DRPSUHJCSADDHW-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 127.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|