C21H20N2O4S — CID 90918909
(1-carbamoyl-1,2,3,4-tetrahydroisoquinolin-8-yl) 4-methylnaphthalene-1-sulfonate (PubChem CID 90918909) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is (1-carbamoyl-1,2,3,4-tetrahydroisoquinolin-8-yl) 4-methylnaphthalene-1-sulfonate.
| Compound Name | (1-carbamoyl-1,2,3,4-tetrahydroisoquinolin-8-yl) 4-methylnaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 90918909 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | (1-carbamoyl-1,2,3,4-tetrahydroisoquinolin-8-yl) 4-methylnaphthalene-1-sulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cccc3c2C(C(N)=O)NCC3)c2ccccc12 |
| InChI | InChI=1S/C21H20N2O4S/c1-13-9-10-18(16-7-3-2-6-15(13)16)28(25,26)27-17-8-4-5-14-11-12-23-20(19(14)17)21(22)24/h2-10,20,23H,11-12H2,1H3,(H2,22,24) |
| InChIKey | GEPUIOMBFODACQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|