C18H4N2O6 — CID 90918962
5,7,14,16-tetraoxo-6,15-dioxatetracyclo[9.7.0.04,17.08,13]octadeca-1(18),2,4(17),8(13),9,11-hexaene-12,18-dicarbonitrile (PubChem CID 90918962) has the molecular formula C18H4N2O6 and a molecular weight of 344.24 g/mol. Its IUPAC name is 5,7,14,16-tetraoxo-6,15-dioxatetracyclo[9.7.0.04,17.08,13]octadeca-1(18),2,4(17),8(13),9,11-hexaene-12,18-dicarbonitrile.
| Compound Name | 5,7,14,16-tetraoxo-6,15-dioxatetracyclo[9.7.0.04,17.08,13]octadeca-1(18),2,4(17),8(13),9,11-hexaene-12,18-dicarbonitrile |
|---|---|
| PubChem CID | 90918962 |
| Molecular Formula | C18H4N2O6 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 5,7,14,16-tetraoxo-6,15-dioxatetracyclo[9.7.0.04,17.08,13]octadeca-1(18),2,4(17),8(13),9,11-hexaene-12,18-dicarbonitrile |
| SMILES | N#Cc1c2ccc3c1C(=O)OC(=O)c1c(ccc-2c1C#N)C(=O)OC3=O |
| InChI | InChI=1S/C18H4N2O6/c19-5-11-7-1-3-9-13(11)17(23)26-18(24)14-10(16(22)25-15(9)21)4-2-8(7)12(14)6-20/h1-4H |
| InChIKey | QXRALEFTNZZPDM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 134.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|