C28H52O6 — CID 90919301
[(2R)-3-hydroxy-2-[2-(oxan-2-yloxy)ethoxy]propyl] octadec-9-enoate (PubChem CID 90919301) has the molecular formula C28H52O6 and a molecular weight of 484.72 g/mol. Its IUPAC name is [(2R)-3-hydroxy-2-[2-(oxan-2-yloxy)ethoxy]propyl] octadec-9-enoate.
| Compound Name | [(2R)-3-hydroxy-2-[2-(oxan-2-yloxy)ethoxy]propyl] octadec-9-enoate |
|---|---|
| PubChem CID | 90919301 |
| Molecular Formula | C28H52O6 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.38 |
| IUPAC Name | [(2R)-3-hydroxy-2-[2-(oxan-2-yloxy)ethoxy]propyl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC[C@@H](CO)OCCOC1CCCCO1 |
| InChI | InChI=1S/C28H52O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-27(30)34-25-26(24-29)31-22-23-33-28-20-17-18-21-32-28/h9-10,26,28-29H,2-8,11-25H2,1H3/t26-,28?/m1/s1 |
| InChIKey | IINSDXZAIBFXAT-HSLSYKTRSA-N |
| XLogP | 6.49 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|