C27H46FNO5 — CID 90919850
1-[4-(4,6-dimethyl-3-oxoheptan-2-yl)-5-methyl-2-oxo-3-pentyl-1,3-oxazolidin-5-yl]propyl 2-fluoro-2,3-dimethylbut-3-enoate (PubChem CID 90919850) has the molecular formula C27H46FNO5 and a molecular weight of 483.67 g/mol. Its IUPAC name is 1-[4-(4,6-dimethyl-3-oxoheptan-2-yl)-5-methyl-2-oxo-3-pentyl-1,3-oxazolidin-5-yl]propyl 2-fluoro-2,3-dimethylbut-3-enoate.
| Compound Name | 1-[4-(4,6-dimethyl-3-oxoheptan-2-yl)-5-methyl-2-oxo-3-pentyl-1,3-oxazolidin-5-yl]propyl 2-fluoro-2,3-dimethylbut-3-enoate |
|---|---|
| PubChem CID | 90919850 |
| Molecular Formula | C27H46FNO5 |
| Molecular Weight | 483.67 g/mol |
| Exact Mass | 483.34 |
| IUPAC Name | 1-[4-(4,6-dimethyl-3-oxoheptan-2-yl)-5-methyl-2-oxo-3-pentyl-1,3-oxazolidin-5-yl]propyl 2-fluoro-2,3-dimethylbut-3-enoate |
| SMILES | C=C(C)C(C)(F)C(=O)OC(CC)C1(C)OC(=O)N(CCCCC)C1C(C)C(=O)C(C)CC(C)C |
| InChI | InChI=1S/C27H46FNO5/c1-11-13-14-15-29-23(20(8)22(30)19(7)16-17(3)4)27(10,34-25(29)32)21(12-2)33-24(31)26(9,28)18(5)6/h17,19-21,23H,5,11-16H2,1-4,6-10H3 |
| InChIKey | PWXXLOKZTCNYAW-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.67 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|