About (E)-7-bromo-3-methylnon-6-ene-4,5-diimine
(E)-7-bromo-3-methylnon-6-ene-4,5-diimine (PubChem CID 90919953) has the molecular formula C10H17BrN2
and a molecular weight of 245.16 g/mol. Its IUPAC name is (E)-7-bromo-3-methylnon-6-ene-4,5-diimine.
Molecular Properties
| Compound Name | (E)-7-bromo-3-methylnon-6-ene-4,5-diimine |
| PubChem CID | 90919953 |
| Molecular Formula | C10H17BrN2 |
| Molecular Weight | 245.16 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | (E)-7-bromo-3-methylnon-6-ene-4,5-diimine |
| SMILES | [H]/N=C(\C=C(\Br)CC)C(=N/[H])/C(C)CC |
| InChI | InChI=1S/C10H17BrN2/c1-4-7(3)10(13)9(12)6-8(11)5-2/h6-7,12-13H,4-5H2,1-3H3/b8-6+,12-9+,13-10+ |
| InChIKey | WCXRPXNSLROXDK-ATELOPIESA-N |
| XLogP | 3.76 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.16 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-7-bromo-3-methylnon-6-ene-4,5-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-7-bromo-3-methylnon-6-ene-4,5-diimine?
The IUPAC name of (E)-7-bromo-3-methylnon-6-ene-4,5-diimine (CID 90919953) is (E)-7-bromo-3-methylnon-6-ene-4,5-diimine.
What is the SMILES notation for (E)-7-bromo-3-methylnon-6-ene-4,5-diimine?
The canonical SMILES for (E)-7-bromo-3-methylnon-6-ene-4,5-diimine is [H]/N=C(\C=C(\Br)CC)C(=N/[H])/C(C)CC.
What is the InChIKey of (E)-7-bromo-3-methylnon-6-ene-4,5-diimine?
The InChIKey is WCXRPXNSLROXDK-ATELOPIESA-N. The full InChI is InChI=1S/C10H17BrN2/c1-4-7(3)10(13)9(12)6-8(11)5-2/h6-7,12-13H,4-5H2,1-3H3/b8-6+,12-9+,13-10+.
What are the key properties of (E)-7-bromo-3-methylnon-6-ene-4,5-diimine?
(E)-7-bromo-3-methylnon-6-ene-4,5-diimine has a molecular weight of 245.16 g/mol, XLogP of 3.76, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-7-bromo-3-methylnon-6-ene-4,5-diimine is sourced from PubChem (CID 90919953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).