C18H17F3N2O3S — CID 9091999
N-[2-(3-methoxyanilino)-2-oxoethyl]-N-methyl-4-(trifluoromethylsulfanyl)benzamide (PubChem CID 9091999) has the molecular formula C18H17F3N2O3S and a molecular weight of 398.41 g/mol. Its IUPAC name is N-[2-(3-methoxyanilino)-2-oxoethyl]-N-methyl-4-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-[2-(3-methoxyanilino)-2-oxoethyl]-N-methyl-4-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 9091999 |
| Molecular Formula | C18H17F3N2O3S |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | N-[2-(3-methoxyanilino)-2-oxoethyl]-N-methyl-4-(trifluoromethylsulfanyl)benzamide |
| SMILES | COc1cccc(NC(=O)CN(C)C(=O)c2ccc(SC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C18H17F3N2O3S/c1-23(11-16(24)22-13-4-3-5-14(10-13)26-2)17(25)12-6-8-15(9-7-12)27-18(19,20)21/h3-10H,11H2,1-2H3,(H,22,24) |
| InChIKey | VJJJTRKSGBAKTP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |