About 3-nitro-1H-indol-6-amine
3-nitro-1H-indol-6-amine (PubChem CID 90920092) has the molecular formula C8H7N3O2
and a molecular weight of 177.16 g/mol. Its IUPAC name is 3-nitro-1H-indol-6-amine.
Molecular Properties
| Compound Name | 3-nitro-1H-indol-6-amine |
| PubChem CID | 90920092 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 3-nitro-1H-indol-6-amine |
| SMILES | Nc1ccc2c([N+](=O)[O-])c[nH]c2c1 |
| InChI | InChI=1S/C8H7N3O2/c9-5-1-2-6-7(3-5)10-4-8(6)11(12)13/h1-4,10H,9H2 |
| InChIKey | DDDQFQPLOWOIQP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitro-1H-indol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitro-1H-indol-6-amine?
The IUPAC name of 3-nitro-1H-indol-6-amine (CID 90920092) is 3-nitro-1H-indol-6-amine.
What is the SMILES notation for 3-nitro-1H-indol-6-amine?
The canonical SMILES for 3-nitro-1H-indol-6-amine is Nc1ccc2c([N+](=O)[O-])c[nH]c2c1.
What is the InChIKey of 3-nitro-1H-indol-6-amine?
The InChIKey is DDDQFQPLOWOIQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2/c9-5-1-2-6-7(3-5)10-4-8(6)11(12)13/h1-4,10H,9H2.
What are the key properties of 3-nitro-1H-indol-6-amine?
3-nitro-1H-indol-6-amine has a molecular weight of 177.16 g/mol, XLogP of 1.66, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-1H-indol-6-amine is sourced from PubChem (CID 90920092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).