About 5-methoxy-2,7-dimethyloct-7-en-4-ol
5-methoxy-2,7-dimethyloct-7-en-4-ol (PubChem CID 90920170) has the molecular formula C11H22O2
and a molecular weight of 186.29 g/mol. Its IUPAC name is 5-methoxy-2,7-dimethyloct-7-en-4-ol.
Molecular Properties
| Compound Name | 5-methoxy-2,7-dimethyloct-7-en-4-ol |
| PubChem CID | 90920170 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 5-methoxy-2,7-dimethyloct-7-en-4-ol |
| SMILES | C=C(C)CC(OC)C(O)CC(C)C |
| InChI | InChI=1S/C11H22O2/c1-8(2)6-10(12)11(13-5)7-9(3)4/h8,10-12H,3,6-7H2,1-2,4-5H3 |
| InChIKey | WXHGKWBWXOQKPP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-2,7-dimethyloct-7-en-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2,7-dimethyloct-7-en-4-ol?
The IUPAC name of 5-methoxy-2,7-dimethyloct-7-en-4-ol (CID 90920170) is 5-methoxy-2,7-dimethyloct-7-en-4-ol.
What is the SMILES notation for 5-methoxy-2,7-dimethyloct-7-en-4-ol?
The canonical SMILES for 5-methoxy-2,7-dimethyloct-7-en-4-ol is C=C(C)CC(OC)C(O)CC(C)C.
What is the InChIKey of 5-methoxy-2,7-dimethyloct-7-en-4-ol?
The InChIKey is WXHGKWBWXOQKPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2/c1-8(2)6-10(12)11(13-5)7-9(3)4/h8,10-12H,3,6-7H2,1-2,4-5H3.
What are the key properties of 5-methoxy-2,7-dimethyloct-7-en-4-ol?
5-methoxy-2,7-dimethyloct-7-en-4-ol has a molecular weight of 186.29 g/mol, XLogP of 2.37, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2,7-dimethyloct-7-en-4-ol is sourced from PubChem (CID 90920170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).