About benzyl 2-[5-(3,3-dimethylbutyl)-2-methylphenyl]-1H-imidazole-5-carboxylate
benzyl 2-[5-(3,3-dimethylbutyl)-2-methylphenyl]-1H-imidazole-5-carboxylate (PubChem CID 90921024) has the molecular formula C24H28N2O2
and a molecular weight of 376.50 g/mol. Its IUPAC name is benzyl 2-[5-(3,3-dimethylbutyl)-2-methylphenyl]-1H-imidazole-5-carboxylate.
Molecular Properties
| Compound Name | benzyl 2-[5-(3,3-dimethylbutyl)-2-methylphenyl]-1H-imidazole-5-carboxylate |
| PubChem CID | 90921024 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | benzyl 2-[5-(3,3-dimethylbutyl)-2-methylphenyl]-1H-imidazole-5-carboxylate |
| SMILES | Cc1ccc(CCC(C)(C)C)cc1-c1ncc(C(=O)OCc2ccccc2)[nH]1 |
| InChI | InChI=1S/C24H28N2O2/c1-17-10-11-18(12-13-24(2,3)4)14-20(17)22-25-15-21(26-22)23(27)28-16-19-8-6-5-7-9-19/h5-11,14-15H,12-13,16H2,1-4H3,(H,25,26) |
| InChIKey | VJIOXAJLLAFPLX-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl 2-[5-(3,3-dimethylbutyl)-2-methylphenyl]-1H-imidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[5-(3,3-dimethylbutyl)-2-methylphenyl]-1H-imidazole-5-carboxylate?
The IUPAC name of benzyl 2-[5-(3,3-dimethylbutyl)-2-methylphenyl]-1H-imidazole-5-carboxylate (CID 90921024) is benzyl 2-[5-(3,3-dimethylbutyl)-2-methylphenyl]-1H-imidazole-5-carboxylate.
What is the SMILES notation for benzyl 2-[5-(3,3-dimethylbutyl)-2-methylphenyl]-1H-imidazole-5-carboxylate?
The canonical SMILES for benzyl 2-[5-(3,3-dimethylbutyl)-2-methylphenyl]-1H-imidazole-5-carboxylate is Cc1ccc(CCC(C)(C)C)cc1-c1ncc(C(=O)OCc2ccccc2)[nH]1.
What is the InChIKey of benzyl 2-[5-(3,3-dimethylbutyl)-2-methylphenyl]-1H-imidazole-5-carboxylate?
The InChIKey is VJIOXAJLLAFPLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N2O2/c1-17-10-11-18(12-13-24(2,3)4)14-20(17)22-25-15-21(26-22)23(27)28-16-19-8-6-5-7-9-19/h5-11,14-15H,12-13,16H2,1-4H3,(H,25,26).
What are the key properties of benzyl 2-[5-(3,3-dimethylbutyl)-2-methylphenyl]-1H-imidazole-5-carboxylate?
benzyl 2-[5-(3,3-dimethylbutyl)-2-methylphenyl]-1H-imidazole-5-carboxylate has a molecular weight of 376.50 g/mol, XLogP of 5.72, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[5-(3,3-dimethylbutyl)-2-methylphenyl]-1H-imidazole-5-carboxylate is sourced from PubChem (CID 90921024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).