C12H12BrNO4 — CID 90921388
(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 3-bromopropanoate (PubChem CID 90921388) has the molecular formula C12H12BrNO4 and a molecular weight of 314.14 g/mol. Its IUPAC name is (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 3-bromopropanoate.
| Compound Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 3-bromopropanoate |
|---|---|
| PubChem CID | 90921388 |
| Molecular Formula | C12H12BrNO4 |
| Molecular Weight | 314.14 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 3-bromopropanoate |
| SMILES | O=C(CCBr)On1c(O)c2c(c1O)C1C=CC2C1 |
| InChI | InChI=1S/C12H12BrNO4/c13-4-3-8(15)18-14-11(16)9-6-1-2-7(5-6)10(9)12(14)17/h1-2,6-7,16-17H,3-5H2 |
| InChIKey | MOSRQMOIBBKGIO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.14 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|