C15H19NO2 — CID 90921768
11-methyl-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-9,12-diene-10,12-diol (PubChem CID 90921768) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 11-methyl-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-9,12-diene-10,12-diol.
| Compound Name | 11-methyl-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-9,12-diene-10,12-diol |
|---|---|
| PubChem CID | 90921768 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 11-methyl-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-9,12-diene-10,12-diol |
| SMILES | Cn1c(O)c2c(c1O)C1CC2C2C3CCC(C3)C12 |
| InChI | InChI=1S/C15H19NO2/c1-16-14(17)12-8-5-9(13(12)15(16)18)11-7-3-2-6(4-7)10(8)11/h6-11,17-18H,2-5H2,1H3 |
| InChIKey | MMGOXIICVTWBPM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|