C26H14F8N2O4 — CID 90921820
4,8-difluoro-5-hydroxy-2,6-bis[[4-(trifluoromethyl)phenyl]methyl]-5H-pyrrolo[3,4-f]isoindole-1,3,7-trione (PubChem CID 90921820) has the molecular formula C26H14F8N2O4 and a molecular weight of 570.39 g/mol. Its IUPAC name is 4,8-difluoro-5-hydroxy-2,6-bis[[4-(trifluoromethyl)phenyl]methyl]-5H-pyrrolo[3,4-f]isoindole-1,3,7-trione.
| Compound Name | 4,8-difluoro-5-hydroxy-2,6-bis[[4-(trifluoromethyl)phenyl]methyl]-5H-pyrrolo[3,4-f]isoindole-1,3,7-trione |
|---|---|
| PubChem CID | 90921820 |
| Molecular Formula | C26H14F8N2O4 |
| Molecular Weight | 570.39 g/mol |
| Exact Mass | 570.08 |
| IUPAC Name | 4,8-difluoro-5-hydroxy-2,6-bis[[4-(trifluoromethyl)phenyl]methyl]-5H-pyrrolo[3,4-f]isoindole-1,3,7-trione |
| SMILES | O=C1c2c(F)c3c(c(F)c2C(=O)N1Cc1ccc(C(F)(F)F)cc1)C(O)N(Cc1ccc(C(F)(F)F)cc1)C3=O |
| InChI | InChI=1S/C26H14F8N2O4/c27-19-15-16(22(38)35(21(15)37)9-11-1-5-13(6-2-11)25(29,30)31)20(28)18-17(19)23(39)36(24(18)40)10-12-3-7-14(8-4-12)26(32,33)34/h1-8,21,37H,9-10H2 |
| InChIKey | TZHWYVGHUOPOJS-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.39 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|