C11H13NO — CID 90921916
6-(nitrosomethyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 90921916) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 6-(nitrosomethyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-(nitrosomethyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 90921916 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 6-(nitrosomethyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | O=NCc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C11H13NO/c13-12-8-9-5-6-10-3-1-2-4-11(10)7-9/h5-7H,1-4,8H2 |
| InChIKey | VROYWMRRXBJJFO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |