About 3-ethyl-1-methyl-2,4-dihydroimidazol-4-ylium
3-ethyl-1-methyl-2,4-dihydroimidazol-4-ylium (PubChem CID 90922328) has the molecular formula C6H11N2+
and a molecular weight of 111.17 g/mol. Its IUPAC name is 3-ethyl-1-methyl-2,4-dihydroimidazol-4-ylium.
Molecular Properties
| Compound Name | 3-ethyl-1-methyl-2,4-dihydroimidazol-4-ylium |
| PubChem CID | 90922328 |
| Molecular Formula | C6H11N2+ |
| Molecular Weight | 111.17 g/mol |
| Exact Mass | 111.09 |
| IUPAC Name | 3-ethyl-1-methyl-2,4-dihydroimidazol-4-ylium |
| SMILES | CCN1[C+]=CN(C)C1 |
| InChI | InChI=1S/C6H11N2/c1-3-8-5-4-7(2)6-8/h4H,3,6H2,1-2H3/q+1 |
| InChIKey | CZKNBPQLXQFPTO-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.17 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-1-methyl-2,4-dihydroimidazol-4-ylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-methyl-2,4-dihydroimidazol-4-ylium?
The IUPAC name of 3-ethyl-1-methyl-2,4-dihydroimidazol-4-ylium (CID 90922328) is 3-ethyl-1-methyl-2,4-dihydroimidazol-4-ylium.
What is the SMILES notation for 3-ethyl-1-methyl-2,4-dihydroimidazol-4-ylium?
The canonical SMILES for 3-ethyl-1-methyl-2,4-dihydroimidazol-4-ylium is CCN1[C+]=CN(C)C1.
What is the InChIKey of 3-ethyl-1-methyl-2,4-dihydroimidazol-4-ylium?
The InChIKey is CZKNBPQLXQFPTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N2/c1-3-8-5-4-7(2)6-8/h4H,3,6H2,1-2H3/q+1.
What are the key properties of 3-ethyl-1-methyl-2,4-dihydroimidazol-4-ylium?
3-ethyl-1-methyl-2,4-dihydroimidazol-4-ylium has a molecular weight of 111.17 g/mol, XLogP of 0.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-methyl-2,4-dihydroimidazol-4-ylium is sourced from PubChem (CID 90922328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).