C36H50FNO5 — CID 90922779
4-ethoxy-N-[6-[(13S)-11-fluoro-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]hexyl]-N-(2-methoxyethyl)benzamide (PubChem CID 90922779) has the molecular formula C36H50FNO5 and a molecular weight of 595.80 g/mol. Its IUPAC name is 4-ethoxy-N-[6-[(13S)-11-fluoro-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]hexyl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-ethoxy-N-[6-[(13S)-11-fluoro-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]hexyl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 90922779 |
| Molecular Formula | C36H50FNO5 |
| Molecular Weight | 595.80 g/mol |
| Exact Mass | 595.37 |
| IUPAC Name | 4-ethoxy-N-[6-[(13S)-11-fluoro-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]hexyl]-N-(2-methoxyethyl)benzamide |
| SMILES | CCOc1ccc(C(=O)N(CCCCCCC2Cc3cc(O)ccc3C3C(F)C[C@]4(C)C(O)CCC4C23)CCOC)cc1 |
| InChI | InChI=1S/C36H50FNO5/c1-4-43-28-13-10-24(11-14-28)35(41)38(19-20-42-3)18-8-6-5-7-9-25-21-26-22-27(39)12-15-29(26)34-31(37)23-36(2)30(33(25)34)16-17-32(36)40/h10-15,22,25,30-34,39-40H,4-9,16-21,23H2,1-3H3/t25?,30?,31?,32?,33?,34?,36-/m0/s1 |
| InChIKey | QGNUMCSPKHRALY-WNQYGUBASA-N |
| XLogP | 6.92 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.80 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|