C26H17F5N3O+ — CID 90923336
2-(2-fluorophenyl)-5-[[3-fluoro-4-[2-(trifluoromethoxy)phenyl]phenyl]methyl]-3H-imidazo[4,5-c]pyridin-5-ium (PubChem CID 90923336) has the molecular formula C26H17F5N3O+ and a molecular weight of 482.43 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-5-[[3-fluoro-4-[2-(trifluoromethoxy)phenyl]phenyl]methyl]-3H-imidazo[4,5-c]pyridin-5-ium.
| Compound Name | 2-(2-fluorophenyl)-5-[[3-fluoro-4-[2-(trifluoromethoxy)phenyl]phenyl]methyl]-3H-imidazo[4,5-c]pyridin-5-ium |
|---|---|
| PubChem CID | 90923336 |
| Molecular Formula | C26H17F5N3O+ |
| Molecular Weight | 482.43 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 2-(2-fluorophenyl)-5-[[3-fluoro-4-[2-(trifluoromethoxy)phenyl]phenyl]methyl]-3H-imidazo[4,5-c]pyridin-5-ium |
| SMILES | Fc1ccccc1-c1nc2cc[n+](Cc3ccc(-c4ccccc4OC(F)(F)F)c(F)c3)cc2[nH]1 |
| InChI | InChI=1S/C26H16F5N3O/c27-20-7-3-1-6-19(20)25-32-22-11-12-34(15-23(22)33-25)14-16-9-10-17(21(28)13-16)18-5-2-4-8-24(18)35-26(29,30)31/h1-13,15H,14H2/p+1 |
| InChIKey | WXKUVYDZFLLRMZ-UHFFFAOYSA-O |
| XLogP | 6.41 |
| TPSA | 41.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.43 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|