C11H10N2O6 — CID 90923391
3-(2,5-dihydroxypyrrol-1-yl)-3-(2,5-dioxopyrrol-1-yl)propanoic acid (PubChem CID 90923391) has the molecular formula C11H10N2O6 and a molecular weight of 266.21 g/mol. Its IUPAC name is 3-(2,5-dihydroxypyrrol-1-yl)-3-(2,5-dioxopyrrol-1-yl)propanoic acid.
| Compound Name | 3-(2,5-dihydroxypyrrol-1-yl)-3-(2,5-dioxopyrrol-1-yl)propanoic acid |
|---|---|
| PubChem CID | 90923391 |
| Molecular Formula | C11H10N2O6 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 3-(2,5-dihydroxypyrrol-1-yl)-3-(2,5-dioxopyrrol-1-yl)propanoic acid |
| SMILES | O=C(O)CC(N1C(=O)C=CC1=O)n1c(O)ccc1O |
| InChI | InChI=1S/C11H10N2O6/c14-7-1-2-8(15)12(7)6(5-11(18)19)13-9(16)3-4-10(13)17/h1-4,6,14-15H,5H2,(H,18,19) |
| InChIKey | GBLFWHRCGAIULE-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 120.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|