C16H30 — CID 90923601
3,6,9,9,9a-pentamethyl-2,3,3a,4,5,6,7,8-octahydro-1H-cyclopenta[8]annulene (PubChem CID 90923601) has the molecular formula C16H30 and a molecular weight of 222.42 g/mol. Its IUPAC name is 3,6,9,9,9a-pentamethyl-2,3,3a,4,5,6,7,8-octahydro-1H-cyclopenta[8]annulene.
| Compound Name | 3,6,9,9,9a-pentamethyl-2,3,3a,4,5,6,7,8-octahydro-1H-cyclopenta[8]annulene |
|---|---|
| PubChem CID | 90923601 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | 3,6,9,9,9a-pentamethyl-2,3,3a,4,5,6,7,8-octahydro-1H-cyclopenta[8]annulene |
| SMILES | CC1CCC2C(C)CCC2(C)C(C)(C)CC1 |
| InChI | InChI=1S/C16H30/c1-12-6-7-14-13(2)9-11-16(14,5)15(3,4)10-8-12/h12-14H,6-11H2,1-5H3 |
| InChIKey | RJVMMXFTCFXGBY-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |