C21H21F3N2O3 — CID 90923709
[(2S,3S)-2-phenyl-1-(2,2,2-trifluoroacetyl)piperidin-3-yl] N-benzylcarbamate (PubChem CID 90923709) has the molecular formula C21H21F3N2O3 and a molecular weight of 406.40 g/mol. Its IUPAC name is [(2S,3S)-2-phenyl-1-(2,2,2-trifluoroacetyl)piperidin-3-yl] N-benzylcarbamate.
| Compound Name | [(2S,3S)-2-phenyl-1-(2,2,2-trifluoroacetyl)piperidin-3-yl] N-benzylcarbamate |
|---|---|
| PubChem CID | 90923709 |
| Molecular Formula | C21H21F3N2O3 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | [(2S,3S)-2-phenyl-1-(2,2,2-trifluoroacetyl)piperidin-3-yl] N-benzylcarbamate |
| SMILES | O=C(NCc1ccccc1)O[C@H]1CCCN(C(=O)C(F)(F)F)C1c1ccccc1 |
| InChI | InChI=1S/C21H21F3N2O3/c22-21(23,24)19(27)26-13-7-12-17(18(26)16-10-5-2-6-11-16)29-20(28)25-14-15-8-3-1-4-9-15/h1-6,8-11,17-18H,7,12-14H2,(H,25,28)/t17-,18?/m0/s1 |
| InChIKey | SSHLVRGRROTEKU-ZENAZSQFSA-N |
| XLogP | 4.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |