C15H21FN4S — CID 90923751
1-[3-[(3-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]hexane-1,6-diamine (PubChem CID 90923751) has the molecular formula C15H21FN4S and a molecular weight of 308.43 g/mol. Its IUPAC name is 1-[3-[(3-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]hexane-1,6-diamine.
| Compound Name | 1-[3-[(3-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 90923751 |
| Molecular Formula | C15H21FN4S |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 1-[3-[(3-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]hexane-1,6-diamine |
| SMILES | NCCCCCC(N)c1nc(Cc2cccc(F)c2)ns1 |
| InChI | InChI=1S/C15H21FN4S/c16-12-6-4-5-11(9-12)10-14-19-15(21-20-14)13(18)7-2-1-3-8-17/h4-6,9,13H,1-3,7-8,10,17-18H2 |
| InChIKey | AWNBBZPKUKWVPP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|