C8H16N4O2 — CID 90923805
6,6-diamino-3-(2-methylpropyl)-1,3-diazinane-2,4-dione (PubChem CID 90923805) has the molecular formula C8H16N4O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is 6,6-diamino-3-(2-methylpropyl)-1,3-diazinane-2,4-dione.
| Compound Name | 6,6-diamino-3-(2-methylpropyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 90923805 |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 6,6-diamino-3-(2-methylpropyl)-1,3-diazinane-2,4-dione |
| SMILES | CC(C)CN1C(=O)CC(N)(N)NC1=O |
| InChI | InChI=1S/C8H16N4O2/c1-5(2)4-12-6(13)3-8(9,10)11-7(12)14/h5H,3-4,9-10H2,1-2H3,(H,11,14) |
| InChIKey | YNNOCBKAYZNBNE-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|