C10H5F5O — CID 90924056
4-(2,3,4,5,6-pentafluorophenyl)but-3-enal (PubChem CID 90924056) has the molecular formula C10H5F5O and a molecular weight of 236.14 g/mol. Its IUPAC name is 4-(2,3,4,5,6-pentafluorophenyl)but-3-enal.
| Compound Name | 4-(2,3,4,5,6-pentafluorophenyl)but-3-enal |
|---|---|
| PubChem CID | 90924056 |
| Molecular Formula | C10H5F5O |
| Molecular Weight | 236.14 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 4-(2,3,4,5,6-pentafluorophenyl)but-3-enal |
| SMILES | O=CCC=Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H5F5O/c11-6-5(3-1-2-4-16)7(12)9(14)10(15)8(6)13/h1,3-4H,2H2 |
| InChIKey | XQAAMFZLZCBBFT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.14 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|