C16H26N2 — CID 90924335
1-(2-ethylidenenona-3,5-dienyl)-2,4-dimethyl-4,5-dihydroimidazole (PubChem CID 90924335) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 1-(2-ethylidenenona-3,5-dienyl)-2,4-dimethyl-4,5-dihydroimidazole.
| Compound Name | 1-(2-ethylidenenona-3,5-dienyl)-2,4-dimethyl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 90924335 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 1-(2-ethylidenenona-3,5-dienyl)-2,4-dimethyl-4,5-dihydroimidazole |
| SMILES | CC=C(C=CC=CCCC)CN1CC(C)N=C1C |
| InChI | InChI=1S/C16H26N2/c1-5-7-8-9-10-11-16(6-2)13-18-12-14(3)17-15(18)4/h6,8-11,14H,5,7,12-13H2,1-4H3 |
| InChIKey | FMPWFZOSUVMYDF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|