C17H19FN4O3 — CID 9092438
1-(2-fluorophenyl)-6-methyl-4-oxo-N-[2-oxo-2-(propylamino)ethyl]pyridazine-3-carboxamide (PubChem CID 9092438) has the molecular formula C17H19FN4O3 and a molecular weight of 346.36 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-6-methyl-4-oxo-N-[2-oxo-2-(propylamino)ethyl]pyridazine-3-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-6-methyl-4-oxo-N-[2-oxo-2-(propylamino)ethyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 9092438 |
| Molecular Formula | C17H19FN4O3 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-(2-fluorophenyl)-6-methyl-4-oxo-N-[2-oxo-2-(propylamino)ethyl]pyridazine-3-carboxamide |
| SMILES | CCCNC(=O)CNC(=O)c1nn(-c2ccccc2F)c(C)cc1=O |
| InChI | InChI=1S/C17H19FN4O3/c1-3-8-19-15(24)10-20-17(25)16-14(23)9-11(2)22(21-16)13-7-5-4-6-12(13)18/h4-7,9H,3,8,10H2,1-2H3,(H,19,24)(H,20,25) |
| InChIKey | WPCGLISEZQUVIL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |