C20H28N2O2S — CID 90924656
6-(2-ethyl-1,3-dioxolan-2-yl)-1-(2-phenyl-1,3-thiazol-5-yl)hexan-1-amine (PubChem CID 90924656) has the molecular formula C20H28N2O2S and a molecular weight of 360.52 g/mol. Its IUPAC name is 6-(2-ethyl-1,3-dioxolan-2-yl)-1-(2-phenyl-1,3-thiazol-5-yl)hexan-1-amine.
| Compound Name | 6-(2-ethyl-1,3-dioxolan-2-yl)-1-(2-phenyl-1,3-thiazol-5-yl)hexan-1-amine |
|---|---|
| PubChem CID | 90924656 |
| Molecular Formula | C20H28N2O2S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 6-(2-ethyl-1,3-dioxolan-2-yl)-1-(2-phenyl-1,3-thiazol-5-yl)hexan-1-amine |
| SMILES | CCC1(CCCCCC(N)c2cnc(-c3ccccc3)s2)OCCO1 |
| InChI | InChI=1S/C20H28N2O2S/c1-2-20(23-13-14-24-20)12-8-4-7-11-17(21)18-15-22-19(25-18)16-9-5-3-6-10-16/h3,5-6,9-10,15,17H,2,4,7-8,11-14,21H2,1H3 |
| InChIKey | FFMHICQWWHFYGY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|