C22H30N6O2 — CID 90924997
2-[3-amino-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]-1H-pyridazin-5-yl]-N-(pyridin-4-ylmethyl)acetamide (PubChem CID 90924997) has the molecular formula C22H30N6O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-[3-amino-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]-1H-pyridazin-5-yl]-N-(pyridin-4-ylmethyl)acetamide.
| Compound Name | 2-[3-amino-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]-1H-pyridazin-5-yl]-N-(pyridin-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 90924997 |
| Molecular Formula | C22H30N6O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 2-[3-amino-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]-1H-pyridazin-5-yl]-N-(pyridin-4-ylmethyl)acetamide |
| SMILES | C[C@@H]1[C@H]2C[C@@H](C[C@H]1Nc1c(N)n[nH]c(=O)c1CC(=O)NCc1ccncc1)C2(C)C |
| InChI | InChI=1S/C22H30N6O2/c1-12-16-8-14(22(16,2)3)9-17(12)26-19-15(21(30)28-27-20(19)23)10-18(29)25-11-13-4-6-24-7-5-13/h4-7,12,14,16-17H,8-11H2,1-3H3,(H2,23,27)(H,25,29)(H2,26,28,30)/t12-,14+,16-,17-/m1/s1 |
| InChIKey | YEZGMYYEOCCGGL-JWZBEHFJSA-N |
| XLogP | 2.09 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |