About (7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate
(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (PubChem CID 90925353) has the molecular formula C20H24O4
and a molecular weight of 328.41 g/mol. Its IUPAC name is (7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
Molecular Properties
| Compound Name | (7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| PubChem CID | 90925353 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| SMILES | O=C1OC2CC1CCC2OC(=O)C1CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C20H24O4/c21-19-11-3-4-15(16(8-11)24-19)23-20(22)14-7-12-6-13(14)18-10-2-1-9(5-10)17(12)18/h1-2,9-18H,3-8H2 |
| InChIKey | HNIMULQLXBQHQL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate?
The IUPAC name of (7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (CID 90925353) is (7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
What is the SMILES notation for (7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate?
The canonical SMILES for (7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate is O=C1OC2CC1CCC2OC(=O)C1CC2CC1C1C3C=CC(C3)C21.
What is the InChIKey of (7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate?
The InChIKey is HNIMULQLXBQHQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24O4/c21-19-11-3-4-15(16(8-11)24-19)23-20(22)14-7-12-6-13(14)18-10-2-1-9(5-10)17(12)18/h1-2,9-18H,3-8H2.
What are the key properties of (7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate?
(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate has a molecular weight of 328.41 g/mol, XLogP of 2.72, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate is sourced from PubChem (CID 90925353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).