C4H3BrCl5N3 — CID 90925464
4-bromo-3-(1,1,2,2,2-pentachloroethyl)-1,5-dihydro-1,2,4-triazole (PubChem CID 90925464) has the molecular formula C4H3BrCl5N3 and a molecular weight of 350.26 g/mol. Its IUPAC name is 4-bromo-3-(1,1,2,2,2-pentachloroethyl)-1,5-dihydro-1,2,4-triazole.
| Compound Name | 4-bromo-3-(1,1,2,2,2-pentachloroethyl)-1,5-dihydro-1,2,4-triazole |
|---|---|
| PubChem CID | 90925464 |
| Molecular Formula | C4H3BrCl5N3 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 346.80 |
| IUPAC Name | 4-bromo-3-(1,1,2,2,2-pentachloroethyl)-1,5-dihydro-1,2,4-triazole |
| SMILES | ClC(Cl)(Cl)C(Cl)(Cl)C1=NNCN1Br |
| InChI | InChI=1S/C4H3BrCl5N3/c5-13-1-11-12-2(13)3(6,7)4(8,9)10/h11H,1H2 |
| InChIKey | XFUDLUHFNPJIKC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|