C13H20O6 — CID 90926147
4-butoxy-5-(2,2-dimethyl-1,3-dioxolan-4-yl)oxolane-2,3-dione (PubChem CID 90926147) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is 4-butoxy-5-(2,2-dimethyl-1,3-dioxolan-4-yl)oxolane-2,3-dione.
| Compound Name | 4-butoxy-5-(2,2-dimethyl-1,3-dioxolan-4-yl)oxolane-2,3-dione |
|---|---|
| PubChem CID | 90926147 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 4-butoxy-5-(2,2-dimethyl-1,3-dioxolan-4-yl)oxolane-2,3-dione |
| SMILES | CCCCOC1C(=O)C(=O)OC1C1COC(C)(C)O1 |
| InChI | InChI=1S/C13H20O6/c1-4-5-6-16-11-9(14)12(15)18-10(11)8-7-17-13(2,3)19-8/h8,10-11H,4-7H2,1-3H3 |
| InChIKey | OGJLBBPQWCSZOL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|