C25H32Cl2N4 — CID 90927059
1-[4-(3,4-dichlorophenyl)-2-methyl-3,4-dihydronaphthalen-1-yl]-2-[5-(dimethylamino)pentyl]guanidine (PubChem CID 90927059) has the molecular formula C25H32Cl2N4 and a molecular weight of 459.47 g/mol. Its IUPAC name is 1-[4-(3,4-dichlorophenyl)-2-methyl-3,4-dihydronaphthalen-1-yl]-2-[5-(dimethylamino)pentyl]guanidine.
| Compound Name | 1-[4-(3,4-dichlorophenyl)-2-methyl-3,4-dihydronaphthalen-1-yl]-2-[5-(dimethylamino)pentyl]guanidine |
|---|---|
| PubChem CID | 90927059 |
| Molecular Formula | C25H32Cl2N4 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 1-[4-(3,4-dichlorophenyl)-2-methyl-3,4-dihydronaphthalen-1-yl]-2-[5-(dimethylamino)pentyl]guanidine |
| SMILES | CC1=C(N/C(N)=N/CCCCCN(C)C)c2ccccc2C(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C25H32Cl2N4/c1-17-15-21(18-11-12-22(26)23(27)16-18)19-9-5-6-10-20(19)24(17)30-25(28)29-13-7-4-8-14-31(2)3/h5-6,9-12,16,21H,4,7-8,13-15H2,1-3H3,(H3,28,29,30) |
| InChIKey | BPFAOSIBSLMEJP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|