C25H23F3N4O7 — CID 90927439
2-[1-(1,3-benzodioxol-5-yl)-2-[3-[3-(3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-6-yl)propyl]-1,2,4-oxadiazol-5-yl]ethyl]-4,4,4-trifluoro-3-oxobutanoic acid (PubChem CID 90927439) has the molecular formula C25H23F3N4O7 and a molecular weight of 548.47 g/mol. Its IUPAC name is 2-[1-(1,3-benzodioxol-5-yl)-2-[3-[3-(3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-6-yl)propyl]-1,2,4-oxadiazol-5-yl]ethyl]-4,4,4-trifluoro-3-oxobutanoic acid.
| Compound Name | 2-[1-(1,3-benzodioxol-5-yl)-2-[3-[3-(3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-6-yl)propyl]-1,2,4-oxadiazol-5-yl]ethyl]-4,4,4-trifluoro-3-oxobutanoic acid |
|---|---|
| PubChem CID | 90927439 |
| Molecular Formula | C25H23F3N4O7 |
| Molecular Weight | 548.47 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | 2-[1-(1,3-benzodioxol-5-yl)-2-[3-[3-(3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-6-yl)propyl]-1,2,4-oxadiazol-5-yl]ethyl]-4,4,4-trifluoro-3-oxobutanoic acid |
| SMILES | O=C(O)C(C(=O)C(F)(F)F)C(Cc1nc(CCCc2ccc3c(n2)NCCO3)no1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H23F3N4O7/c26-25(27,28)22(33)21(24(34)35)15(13-4-6-16-18(10-13)38-12-37-16)11-20-31-19(32-39-20)3-1-2-14-5-7-17-23(30-14)29-8-9-36-17/h4-7,10,15,21H,1-3,8-9,11-12H2,(H,29,30)(H,34,35) |
| InChIKey | RZSMSAKXJQJFLB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 145.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|