C24H21N3O3 — CID 90927692
2-[[3,5-bis(pyridin-2-ylmethoxy)phenoxy]methyl]pyridine (PubChem CID 90927692) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is 2-[[3,5-bis(pyridin-2-ylmethoxy)phenoxy]methyl]pyridine.
| Compound Name | 2-[[3,5-bis(pyridin-2-ylmethoxy)phenoxy]methyl]pyridine |
|---|---|
| PubChem CID | 90927692 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 2-[[3,5-bis(pyridin-2-ylmethoxy)phenoxy]methyl]pyridine |
| SMILES | c1ccc(COc2cc(OCc3ccccn3)cc(OCc3ccccn3)c2)nc1 |
| InChI | InChI=1S/C24H21N3O3/c1-4-10-25-19(7-1)16-28-22-13-23(29-17-20-8-2-5-11-26-20)15-24(14-22)30-18-21-9-3-6-12-27-21/h1-15H,16-18H2 |
| InChIKey | SRJRXDAKBIESDQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |