C28H54O7 — CID 90927786
3-(3,11-dihydroxytetradecanoyloxy)-11-hydroxytetradecanoic acid (PubChem CID 90927786) has the molecular formula C28H54O7 and a molecular weight of 502.73 g/mol. Its IUPAC name is 3-(3,11-dihydroxytetradecanoyloxy)-11-hydroxytetradecanoic acid.
| Compound Name | 3-(3,11-dihydroxytetradecanoyloxy)-11-hydroxytetradecanoic acid |
|---|---|
| PubChem CID | 90927786 |
| Molecular Formula | C28H54O7 |
| Molecular Weight | 502.73 g/mol |
| Exact Mass | 502.39 |
| IUPAC Name | 3-(3,11-dihydroxytetradecanoyloxy)-11-hydroxytetradecanoic acid |
| SMILES | CCCC(O)CCCCCCCC(O)CC(=O)OC(CCCCCCCC(O)CCC)CC(=O)O |
| InChI | InChI=1S/C28H54O7/c1-3-15-23(29)17-11-7-5-9-13-19-25(31)21-28(34)35-26(22-27(32)33)20-14-10-6-8-12-18-24(30)16-4-2/h23-26,29-31H,3-22H2,1-2H3,(H,32,33) |
| InChIKey | WYEOMFAWZWXDTB-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.73 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|