About [4-[(4-tert-butyl-2,3-difluorophenyl)methyl]cyclohexyl]methanimine
[4-[(4-tert-butyl-2,3-difluorophenyl)methyl]cyclohexyl]methanimine (PubChem CID 90927824) has the molecular formula C18H25F2N
and a molecular weight of 293.40 g/mol. Its IUPAC name is [4-[(4-tert-butyl-2,3-difluorophenyl)methyl]cyclohexyl]methanimine.
Molecular Properties
| Compound Name | [4-[(4-tert-butyl-2,3-difluorophenyl)methyl]cyclohexyl]methanimine |
| PubChem CID | 90927824 |
| Molecular Formula | C18H25F2N |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | [4-[(4-tert-butyl-2,3-difluorophenyl)methyl]cyclohexyl]methanimine |
| SMILES | [H]/N=C/C1CCC(Cc2ccc(C(C)(C)C)c(F)c2F)CC1 |
| InChI | InChI=1S/C18H25F2N/c1-18(2,3)15-9-8-14(16(19)17(15)20)10-12-4-6-13(11-21)7-5-12/h8-9,11-13,21H,4-7,10H2,1-3H3/b21-11+ |
| InChIKey | RAJMMXRTSBIDBC-SRZZPIQSSA-N |
| XLogP | 5.26 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [4-[(4-tert-butyl-2,3-difluorophenyl)methyl]cyclohexyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(4-tert-butyl-2,3-difluorophenyl)methyl]cyclohexyl]methanimine?
The IUPAC name of [4-[(4-tert-butyl-2,3-difluorophenyl)methyl]cyclohexyl]methanimine (CID 90927824) is [4-[(4-tert-butyl-2,3-difluorophenyl)methyl]cyclohexyl]methanimine.
What is the SMILES notation for [4-[(4-tert-butyl-2,3-difluorophenyl)methyl]cyclohexyl]methanimine?
The canonical SMILES for [4-[(4-tert-butyl-2,3-difluorophenyl)methyl]cyclohexyl]methanimine is [H]/N=C/C1CCC(Cc2ccc(C(C)(C)C)c(F)c2F)CC1.
What is the InChIKey of [4-[(4-tert-butyl-2,3-difluorophenyl)methyl]cyclohexyl]methanimine?
The InChIKey is RAJMMXRTSBIDBC-SRZZPIQSSA-N. The full InChI is InChI=1S/C18H25F2N/c1-18(2,3)15-9-8-14(16(19)17(15)20)10-12-4-6-13(11-21)7-5-12/h8-9,11-13,21H,4-7,10H2,1-3H3/b21-11+.
What are the key properties of [4-[(4-tert-butyl-2,3-difluorophenyl)methyl]cyclohexyl]methanimine?
[4-[(4-tert-butyl-2,3-difluorophenyl)methyl]cyclohexyl]methanimine has a molecular weight of 293.40 g/mol, XLogP of 5.26, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(4-tert-butyl-2,3-difluorophenyl)methyl]cyclohexyl]methanimine is sourced from PubChem (CID 90927824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).