C20H28O7 — CID 90927848
3,4-dimethyloxolane-2,5-dione;(2-oxooxolan-3-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 90927848) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is 3,4-dimethyloxolane-2,5-dione;(2-oxooxolan-3-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | 3,4-dimethyloxolane-2,5-dione;(2-oxooxolan-3-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 90927848 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 3,4-dimethyloxolane-2,5-dione;(2-oxooxolan-3-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC1C(=O)OC(=O)C1C.CC1C2CC(C(=O)OC3CCOC3=O)C(C2)C1C |
| InChI | InChI=1S/C14H20O4.C6H8O3/c1-7-8(2)10-5-9(7)6-11(10)13(15)18-12-3-4-17-14(12)16;1-3-4(2)6(8)9-5(3)7/h7-12H,3-6H2,1-2H3;3-4H,1-2H3 |
| InChIKey | GTSRAUZVKMHNJO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|