C20H15Cl2N3O — CID 90927957
(Z)-1-[9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indol-3-yl]-N-methoxymethanimine (PubChem CID 90927957) has the molecular formula C20H15Cl2N3O and a molecular weight of 384.27 g/mol. Its IUPAC name is (Z)-1-[9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indol-3-yl]-N-methoxymethanimine.
| Compound Name | (Z)-1-[9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indol-3-yl]-N-methoxymethanimine |
|---|---|
| PubChem CID | 90927957 |
| Molecular Formula | C20H15Cl2N3O |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | (Z)-1-[9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indol-3-yl]-N-methoxymethanimine |
| SMILES | CO/N=C\c1cc2c3ccccc3n(Cc3cc(Cl)ccc3Cl)c2cn1 |
| InChI | InChI=1S/C20H15Cl2N3O/c1-26-24-10-15-9-17-16-4-2-3-5-19(16)25(20(17)11-23-15)12-13-8-14(21)6-7-18(13)22/h2-11H,12H2,1H3/b24-10- |
| InChIKey | VMSGKPFJKKKACF-VROXFSQNSA-N |
| XLogP | 5.52 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|