About diethyl-methyl-[1-(1H-1,2,4-triazol-5-yl)ethyl]-λ4-sulfane
diethyl-methyl-[1-(1H-1,2,4-triazol-5-yl)ethyl]-λ4-sulfane (PubChem CID 90927998) has the molecular formula C9H19N3S
and a molecular weight of 201.34 g/mol. Its IUPAC name is diethyl-methyl-[1-(1H-1,2,4-triazol-5-yl)ethyl]-λ4-sulfane.
Molecular Properties
| Compound Name | diethyl-methyl-[1-(1H-1,2,4-triazol-5-yl)ethyl]-λ4-sulfane |
| PubChem CID | 90927998 |
| Molecular Formula | C9H19N3S |
| Molecular Weight | 201.34 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | diethyl-methyl-[1-(1H-1,2,4-triazol-5-yl)ethyl]-λ4-sulfane |
| SMILES | CCS(C)(CC)C(C)c1ncn[nH]1 |
| InChI | InChI=1S/C9H19N3S/c1-5-13(4,6-2)8(3)9-10-7-11-12-9/h7-8H,5-6H2,1-4H3,(H,10,11,12) |
| InChIKey | CAZWQNFCGYYELU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze diethyl-methyl-[1-(1H-1,2,4-triazol-5-yl)ethyl]-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl-methyl-[1-(1H-1,2,4-triazol-5-yl)ethyl]-λ4-sulfane?
The IUPAC name of diethyl-methyl-[1-(1H-1,2,4-triazol-5-yl)ethyl]-λ4-sulfane (CID 90927998) is diethyl-methyl-[1-(1H-1,2,4-triazol-5-yl)ethyl]-λ4-sulfane.
What is the SMILES notation for diethyl-methyl-[1-(1H-1,2,4-triazol-5-yl)ethyl]-λ4-sulfane?
The canonical SMILES for diethyl-methyl-[1-(1H-1,2,4-triazol-5-yl)ethyl]-λ4-sulfane is CCS(C)(CC)C(C)c1ncn[nH]1.
What is the InChIKey of diethyl-methyl-[1-(1H-1,2,4-triazol-5-yl)ethyl]-λ4-sulfane?
The InChIKey is CAZWQNFCGYYELU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3S/c1-5-13(4,6-2)8(3)9-10-7-11-12-9/h7-8H,5-6H2,1-4H3,(H,10,11,12).
What are the key properties of diethyl-methyl-[1-(1H-1,2,4-triazol-5-yl)ethyl]-λ4-sulfane?
diethyl-methyl-[1-(1H-1,2,4-triazol-5-yl)ethyl]-λ4-sulfane has a molecular weight of 201.34 g/mol, XLogP of 2.34, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl-methyl-[1-(1H-1,2,4-triazol-5-yl)ethyl]-λ4-sulfane is sourced from PubChem (CID 90927998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).