C6H10N2O3 — CID 90928817
3-amino-1-(2-hydroxyethyl)pyrrole-2,5-diol (PubChem CID 90928817) has the molecular formula C6H10N2O3 and a molecular weight of 158.16 g/mol. Its IUPAC name is 3-amino-1-(2-hydroxyethyl)pyrrole-2,5-diol.
| Compound Name | 3-amino-1-(2-hydroxyethyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 90928817 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 3-amino-1-(2-hydroxyethyl)pyrrole-2,5-diol |
| SMILES | Nc1cc(O)n(CCO)c1O |
| InChI | InChI=1S/C6H10N2O3/c7-4-3-5(10)8(1-2-9)6(4)11/h3,9-11H,1-2,7H2 |
| InChIKey | UIJQIAGBXPJBBK-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |