C35H35ClFNO8S2 — CID 90929144
2-(7-phenylheptanoyloxy)ethyl 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate (PubChem CID 90929144) has the molecular formula C35H35ClFNO8S2 and a molecular weight of 716.25 g/mol. Its IUPAC name is 2-(7-phenylheptanoyloxy)ethyl 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate.
| Compound Name | 2-(7-phenylheptanoyloxy)ethyl 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 90929144 |
| Molecular Formula | C35H35ClFNO8S2 |
| Molecular Weight | 716.25 g/mol |
| Exact Mass | 715.15 |
| IUPAC Name | 2-(7-phenylheptanoyloxy)ethyl 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate |
| SMILES | CC1=NC2=C(C(c3c(F)cccc3Cl)C1C(=O)OCCOC(=O)CCCCCCc1ccccc1)S(=O)(=O)c1ccccc1S(=O)(=O)C2 |
| InChI | InChI=1S/C35H35ClFNO8S2/c1-23-31(35(40)46-21-20-45-30(39)19-8-3-2-5-12-24-13-6-4-7-14-24)33(32-25(36)15-11-16-26(32)37)34-27(38-23)22-47(41,42)28-17-9-10-18-29(28)48(34,43)44/h4,6-7,9-11,13-18,31,33H,2-3,5,8,12,19-22H2,1H3 |
| InChIKey | GBSKWYZXCNIEMN-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 133.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.25 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|