C15H22O5 — CID 90929205
1,2,2,3-tetrakis(1-hydroxycyclopropyl)cyclopropan-1-ol (PubChem CID 90929205) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is 1,2,2,3-tetrakis(1-hydroxycyclopropyl)cyclopropan-1-ol.
| Compound Name | 1,2,2,3-tetrakis(1-hydroxycyclopropyl)cyclopropan-1-ol |
|---|---|
| PubChem CID | 90929205 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 1,2,2,3-tetrakis(1-hydroxycyclopropyl)cyclopropan-1-ol |
| SMILES | OC1(C2C(O)(C3(O)CC3)C2(C2(O)CC2)C2(O)CC2)CC1 |
| InChI | InChI=1S/C15H22O5/c16-10(1-2-10)9-14(11(17)3-4-11,12(18)5-6-12)15(9,20)13(19)7-8-13/h9,16-20H,1-8H2 |
| InChIKey | YYESGJXKHNSOAO-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |