C21H32O8 — CID 90929363
[1-(4-methoxy-4-methylpentoxy)-3-(2-methylprop-2-enoyloxy)propan-2-yl] 5-methyl-4,6-dioxohex-5-enoate (PubChem CID 90929363) has the molecular formula C21H32O8 and a molecular weight of 412.48 g/mol. Its IUPAC name is [1-(4-methoxy-4-methylpentoxy)-3-(2-methylprop-2-enoyloxy)propan-2-yl] 5-methyl-4,6-dioxohex-5-enoate.
| Compound Name | [1-(4-methoxy-4-methylpentoxy)-3-(2-methylprop-2-enoyloxy)propan-2-yl] 5-methyl-4,6-dioxohex-5-enoate |
|---|---|
| PubChem CID | 90929363 |
| Molecular Formula | C21H32O8 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | [1-(4-methoxy-4-methylpentoxy)-3-(2-methylprop-2-enoyloxy)propan-2-yl] 5-methyl-4,6-dioxohex-5-enoate |
| SMILES | C=C(C)C(=O)OCC(COCCCC(C)(C)OC)OC(=O)CCC(=O)C(C)=C=O |
| InChI | InChI=1S/C21H32O8/c1-15(2)20(25)28-14-17(13-27-11-7-10-21(4,5)26-6)29-19(24)9-8-18(23)16(3)12-22/h17H,1,7-11,13-14H2,2-6H3 |
| InChIKey | FMWJPYZDEWEDDU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|