About 6-[2-(4-cyclohexylphenyl)ethenyl]-3-phenyl-1,2,4-trioxane
6-[2-(4-cyclohexylphenyl)ethenyl]-3-phenyl-1,2,4-trioxane (PubChem CID 90929379) has the molecular formula C23H26O3
and a molecular weight of 350.46 g/mol. Its IUPAC name is 6-[2-(4-cyclohexylphenyl)ethenyl]-3-phenyl-1,2,4-trioxane.
Molecular Properties
| Compound Name | 6-[2-(4-cyclohexylphenyl)ethenyl]-3-phenyl-1,2,4-trioxane |
| PubChem CID | 90929379 |
| Molecular Formula | C23H26O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 6-[2-(4-cyclohexylphenyl)ethenyl]-3-phenyl-1,2,4-trioxane |
| SMILES | C(=CC1COC(c2ccccc2)OO1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C23H26O3/c1-3-7-19(8-4-1)20-14-11-18(12-15-20)13-16-22-17-24-23(26-25-22)21-9-5-2-6-10-21/h2,5-6,9-16,19,22-23H,1,3-4,7-8,17H2 |
| InChIKey | PFGQIIZVJUQIPB-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-(4-cyclohexylphenyl)ethenyl]-3-phenyl-1,2,4-trioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(4-cyclohexylphenyl)ethenyl]-3-phenyl-1,2,4-trioxane?
The IUPAC name of 6-[2-(4-cyclohexylphenyl)ethenyl]-3-phenyl-1,2,4-trioxane (CID 90929379) is 6-[2-(4-cyclohexylphenyl)ethenyl]-3-phenyl-1,2,4-trioxane.
What is the SMILES notation for 6-[2-(4-cyclohexylphenyl)ethenyl]-3-phenyl-1,2,4-trioxane?
The canonical SMILES for 6-[2-(4-cyclohexylphenyl)ethenyl]-3-phenyl-1,2,4-trioxane is C(=CC1COC(c2ccccc2)OO1)c1ccc(C2CCCCC2)cc1.
What is the InChIKey of 6-[2-(4-cyclohexylphenyl)ethenyl]-3-phenyl-1,2,4-trioxane?
The InChIKey is PFGQIIZVJUQIPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26O3/c1-3-7-19(8-4-1)20-14-11-18(12-15-20)13-16-22-17-24-23(26-25-22)21-9-5-2-6-10-21/h2,5-6,9-16,19,22-23H,1,3-4,7-8,17H2.
What are the key properties of 6-[2-(4-cyclohexylphenyl)ethenyl]-3-phenyl-1,2,4-trioxane?
6-[2-(4-cyclohexylphenyl)ethenyl]-3-phenyl-1,2,4-trioxane has a molecular weight of 350.46 g/mol, XLogP of 5.79, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(4-cyclohexylphenyl)ethenyl]-3-phenyl-1,2,4-trioxane is sourced from PubChem (CID 90929379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).