C21H31NO4 — CID 90929402
1-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethyl]-3-(methoxymethoxymethyl)-3-methylpiperidine (PubChem CID 90929402) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is 1-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethyl]-3-(methoxymethoxymethyl)-3-methylpiperidine.
| Compound Name | 1-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethyl]-3-(methoxymethoxymethyl)-3-methylpiperidine |
|---|---|
| PubChem CID | 90929402 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 1-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethyl]-3-(methoxymethoxymethyl)-3-methylpiperidine |
| SMILES | COCOCC1(C)CCCN(C(CC2=CC=CCC2)C2=COC=CO2)C1 |
| InChI | InChI=1S/C21H31NO4/c1-21(16-25-17-23-2)9-6-10-22(15-21)19(20-14-24-11-12-26-20)13-18-7-4-3-5-8-18/h3-4,7,11-12,14,19H,5-6,8-10,13,15-17H2,1-2H3 |
| InChIKey | IRHQGGQAZLXGIF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|