C12H17NO2 — CID 90929603
1-ethenyl-3-(2-methoxyprop-1-enyl)-5-methyl-2,6-dihydropyridin-2-ol (PubChem CID 90929603) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 1-ethenyl-3-(2-methoxyprop-1-enyl)-5-methyl-2,6-dihydropyridin-2-ol.
| Compound Name | 1-ethenyl-3-(2-methoxyprop-1-enyl)-5-methyl-2,6-dihydropyridin-2-ol |
|---|---|
| PubChem CID | 90929603 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 1-ethenyl-3-(2-methoxyprop-1-enyl)-5-methyl-2,6-dihydropyridin-2-ol |
| SMILES | C=CN1CC(C)=C=C(C=C(C)OC)C1O |
| InChI | InChI=1S/C12H17NO2/c1-5-13-8-9(2)6-11(12(13)14)7-10(3)15-4/h5,7,12,14H,1,8H2,2-4H3 |
| InChIKey | WTYCPLLDPIMSCC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|