C32H38F2N2O7 — CID 90929697
(3R,5R)-5-[(1S,2S)-3-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-2-[(3,5-difluorophenyl)methyl]-1-hydroxy-3-oxopropyl]-2-tert-butyl-3-prop-2-enoxypyrrolidine-1-carboxylic acid (PubChem CID 90929697) has the molecular formula C32H38F2N2O7 and a molecular weight of 600.66 g/mol. Its IUPAC name is (3R,5R)-5-[(1S,2S)-3-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-2-[(3,5-difluorophenyl)methyl]-1-hydroxy-3-oxopropyl]-2-tert-butyl-3-prop-2-enoxypyrrolidine-1-carboxylic acid.
| Compound Name | (3R,5R)-5-[(1S,2S)-3-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-2-[(3,5-difluorophenyl)methyl]-1-hydroxy-3-oxopropyl]-2-tert-butyl-3-prop-2-enoxypyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 90929697 |
| Molecular Formula | C32H38F2N2O7 |
| Molecular Weight | 600.66 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | (3R,5R)-5-[(1S,2S)-3-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-2-[(3,5-difluorophenyl)methyl]-1-hydroxy-3-oxopropyl]-2-tert-butyl-3-prop-2-enoxypyrrolidine-1-carboxylic acid |
| SMILES | C=CCO[C@@H]1C[C@H]([C@@H](O)[C@H](Cc2cc(F)cc(F)c2)C(=O)N2C(=O)OC[C@@H]2Cc2ccccc2)N(C(=O)O)C1C(C)(C)C |
| InChI | InChI=1S/C32H38F2N2O7/c1-5-11-42-26-17-25(36(30(39)40)28(26)32(2,3)4)27(37)24(15-20-12-21(33)16-22(34)13-20)29(38)35-23(18-43-31(35)41)14-19-9-7-6-8-10-19/h5-10,12-13,16,23-28,37H,1,11,14-15,17-18H2,2-4H3,(H,39,40)/t23-,24-,25+,26+,27-,28?/m0/s1 |
| InChIKey | QPSMUHATFZMSRB-WGIPCBILSA-N |
| XLogP | 4.81 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.66 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|